C12H10F2N2O3 — CID 43484508
1-(3,4-difluorophenyl)-N-methyl-1-(5-nitrofuran-2-yl)methanamine (PubChem CID 43484508) has the molecular formula C12H10F2N2O3 and a molecular weight of 268.22 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-N-methyl-1-(5-nitrofuran-2-yl)methanamine.
| Compound Name | 1-(3,4-difluorophenyl)-N-methyl-1-(5-nitrofuran-2-yl)methanamine |
|---|---|
| PubChem CID | 43484508 |
| Molecular Formula | C12H10F2N2O3 |
| Molecular Weight | 268.22 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | 1-(3,4-difluorophenyl)-N-methyl-1-(5-nitrofuran-2-yl)methanamine |
| SMILES | CNC(c1ccc(F)c(F)c1)c1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C12H10F2N2O3/c1-15-12(7-2-3-8(13)9(14)6-7)10-4-5-11(19-10)16(17)18/h2-6,12,15H,1H3 |
| InChIKey | XPWWGGVWIUOYEK-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 68.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.22 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|