C15H15F2N — CID 43484623
1-(3,4-difluorophenyl)-N-methyl-2-phenylethanamine (PubChem CID 43484623) has the molecular formula C15H15F2N and a molecular weight of 247.29 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-N-methyl-2-phenylethanamine.
| Compound Name | 1-(3,4-difluorophenyl)-N-methyl-2-phenylethanamine |
|---|---|
| PubChem CID | 43484623 |
| Molecular Formula | C15H15F2N |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | 1-(3,4-difluorophenyl)-N-methyl-2-phenylethanamine |
| SMILES | CNC(Cc1ccccc1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C15H15F2N/c1-18-15(9-11-5-3-2-4-6-11)12-7-8-13(16)14(17)10-12/h2-8,10,15,18H,9H2,1H3 |
| InChIKey | NWPLDEFLHOEAQD-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |