C10H14F2N2 — CID 116948387
1-(3,4-difluorophenyl)-N-methylpropane-1,3-diamine (PubChem CID 116948387) has the molecular formula C10H14F2N2 and a molecular weight of 200.23 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-N-methylpropane-1,3-diamine.
| Compound Name | 1-(3,4-difluorophenyl)-N-methylpropane-1,3-diamine |
|---|---|
| PubChem CID | 116948387 |
| Molecular Formula | C10H14F2N2 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.11 |
| IUPAC Name | 1-(3,4-difluorophenyl)-N-methylpropane-1,3-diamine |
| SMILES | CNC(CCN)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C10H14F2N2/c1-14-10(4-5-13)7-2-3-8(11)9(12)6-7/h2-3,6,10,14H,4-5,13H2,1H3 |
| InChIKey | GQRKHTFPPNZOQC-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |