C12H14F5N — CID 43484643
1-(4-ethylphenyl)-2,2,3,3,3-pentafluoro-N-methylpropan-1-amine (PubChem CID 43484643) has the molecular formula C12H14F5N and a molecular weight of 267.24 g/mol. Its IUPAC name is 1-(4-ethylphenyl)-2,2,3,3,3-pentafluoro-N-methylpropan-1-amine.
| Compound Name | 1-(4-ethylphenyl)-2,2,3,3,3-pentafluoro-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 43484643 |
| Molecular Formula | C12H14F5N |
| Molecular Weight | 267.24 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 1-(4-ethylphenyl)-2,2,3,3,3-pentafluoro-N-methylpropan-1-amine |
| SMILES | CCc1ccc(C(NC)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H14F5N/c1-3-8-4-6-9(7-5-8)10(18-2)11(13,14)12(15,16)17/h4-7,10,18H,3H2,1-2H3 |
| InChIKey | RGEMIIXKQCYOPR-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.24 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|