C15H21F3N2 — CID 70653800
N-[1-(4-ethylphenyl)-2,2,2-trifluoroethyl]piperidin-4-amine (PubChem CID 70653800) has the molecular formula C15H21F3N2 and a molecular weight of 286.34 g/mol. Its IUPAC name is N-[1-(4-ethylphenyl)-2,2,2-trifluoroethyl]piperidin-4-amine.
| Compound Name | N-[1-(4-ethylphenyl)-2,2,2-trifluoroethyl]piperidin-4-amine |
|---|---|
| PubChem CID | 70653800 |
| Molecular Formula | C15H21F3N2 |
| Molecular Weight | 286.34 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | N-[1-(4-ethylphenyl)-2,2,2-trifluoroethyl]piperidin-4-amine |
| SMILES | CCc1ccc(C(NC2CCNCC2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H21F3N2/c1-2-11-3-5-12(6-4-11)14(15(16,17)18)20-13-7-9-19-10-8-13/h3-6,13-14,19-20H,2,7-10H2,1H3 |
| InChIKey | RWVVQFUUSPXKFW-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.34 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |