C15H14ClF2N — CID 43490220
N-[(3-chlorophenyl)-(2,5-difluorophenyl)methyl]ethanamine (PubChem CID 43490220) has the molecular formula C15H14ClF2N and a molecular weight of 281.73 g/mol. Its IUPAC name is N-[(3-chlorophenyl)-(2,5-difluorophenyl)methyl]ethanamine.
| Compound Name | N-[(3-chlorophenyl)-(2,5-difluorophenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 43490220 |
| Molecular Formula | C15H14ClF2N |
| Molecular Weight | 281.73 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | N-[(3-chlorophenyl)-(2,5-difluorophenyl)methyl]ethanamine |
| SMILES | CCNC(c1cccc(Cl)c1)c1cc(F)ccc1F |
| InChI | InChI=1S/C15H14ClF2N/c1-2-19-15(10-4-3-5-11(16)8-10)13-9-12(17)6-7-14(13)18/h3-9,15,19H,2H2,1H3 |
| InChIKey | NQTSLOXSXMNEDS-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.73 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |