C18H22ClN — CID 64989691
N-[(3-chlorophenyl)-(2,4,5-trimethylphenyl)methyl]ethanamine (PubChem CID 64989691) has the molecular formula C18H22ClN and a molecular weight of 287.83 g/mol. Its IUPAC name is N-[(3-chlorophenyl)-(2,4,5-trimethylphenyl)methyl]ethanamine.
| Compound Name | N-[(3-chlorophenyl)-(2,4,5-trimethylphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 64989691 |
| Molecular Formula | C18H22ClN |
| Molecular Weight | 287.83 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | N-[(3-chlorophenyl)-(2,4,5-trimethylphenyl)methyl]ethanamine |
| SMILES | CCNC(c1cccc(Cl)c1)c1cc(C)c(C)cc1C |
| InChI | InChI=1S/C18H22ClN/c1-5-20-18(15-7-6-8-16(19)11-15)17-10-13(3)12(2)9-14(17)4/h6-11,18,20H,5H2,1-4H3 |
| InChIKey | NMOJTKOVGIEFNE-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.83 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |