C13H18F3NO3 — CID 43490252
N-ethyl-2,2,2-trifluoro-1-(2,4,6-trimethoxyphenyl)ethanamine (PubChem CID 43490252) has the molecular formula C13H18F3NO3 and a molecular weight of 293.29 g/mol. Its IUPAC name is N-ethyl-2,2,2-trifluoro-1-(2,4,6-trimethoxyphenyl)ethanamine.
| Compound Name | N-ethyl-2,2,2-trifluoro-1-(2,4,6-trimethoxyphenyl)ethanamine |
|---|---|
| PubChem CID | 43490252 |
| Molecular Formula | C13H18F3NO3 |
| Molecular Weight | 293.29 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | N-ethyl-2,2,2-trifluoro-1-(2,4,6-trimethoxyphenyl)ethanamine |
| SMILES | CCNC(c1c(OC)cc(OC)cc1OC)C(F)(F)F |
| InChI | InChI=1S/C13H18F3NO3/c1-5-17-12(13(14,15)16)11-9(19-3)6-8(18-2)7-10(11)20-4/h6-7,12,17H,5H2,1-4H3 |
| InChIKey | LSCOXNIZTANBIU-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.29 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |