C13H19F2NO3 — CID 80604341
N-ethyl-2,2-difluoro-1-(2,4,6-trimethoxyphenyl)ethanamine (PubChem CID 80604341) has the molecular formula C13H19F2NO3 and a molecular weight of 275.30 g/mol. Its IUPAC name is N-ethyl-2,2-difluoro-1-(2,4,6-trimethoxyphenyl)ethanamine.
| Compound Name | N-ethyl-2,2-difluoro-1-(2,4,6-trimethoxyphenyl)ethanamine |
|---|---|
| PubChem CID | 80604341 |
| Molecular Formula | C13H19F2NO3 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | N-ethyl-2,2-difluoro-1-(2,4,6-trimethoxyphenyl)ethanamine |
| SMILES | CCNC(c1c(OC)cc(OC)cc1OC)C(F)F |
| InChI | InChI=1S/C13H19F2NO3/c1-5-16-12(13(14)15)11-9(18-3)6-8(17-2)7-10(11)19-4/h6-7,12-13,16H,5H2,1-4H3 |
| InChIKey | VRBYFVVRDQXCIX-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |