C15H18BrNO3 — CID 43490697
N-[(5-bromofuran-2-yl)-(2,4-dimethoxyphenyl)methyl]ethanamine (PubChem CID 43490697) has the molecular formula C15H18BrNO3 and a molecular weight of 340.22 g/mol. Its IUPAC name is N-[(5-bromofuran-2-yl)-(2,4-dimethoxyphenyl)methyl]ethanamine.
| Compound Name | N-[(5-bromofuran-2-yl)-(2,4-dimethoxyphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 43490697 |
| Molecular Formula | C15H18BrNO3 |
| Molecular Weight | 340.22 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | N-[(5-bromofuran-2-yl)-(2,4-dimethoxyphenyl)methyl]ethanamine |
| SMILES | CCNC(c1ccc(Br)o1)c1ccc(OC)cc1OC |
| InChI | InChI=1S/C15H18BrNO3/c1-4-17-15(12-7-8-14(16)20-12)11-6-5-10(18-2)9-13(11)19-3/h5-9,15,17H,4H2,1-3H3 |
| InChIKey | UYFRRLBFCLNCDO-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 43.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.22 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |