C13H12BrClO3 — CID 61086394
2-bromo-5-[chloro-(2,4-dimethoxyphenyl)methyl]furan (PubChem CID 61086394) has the molecular formula C13H12BrClO3 and a molecular weight of 331.59 g/mol. Its IUPAC name is 2-bromo-5-[chloro-(2,4-dimethoxyphenyl)methyl]furan.
| Compound Name | 2-bromo-5-[chloro-(2,4-dimethoxyphenyl)methyl]furan |
|---|---|
| PubChem CID | 61086394 |
| Molecular Formula | C13H12BrClO3 |
| Molecular Weight | 331.59 g/mol |
| Exact Mass | 329.97 |
| IUPAC Name | 2-bromo-5-[chloro-(2,4-dimethoxyphenyl)methyl]furan |
| SMILES | COc1ccc(C(Cl)c2ccc(Br)o2)c(OC)c1 |
| InChI | InChI=1S/C13H12BrClO3/c1-16-8-3-4-9(11(7-8)17-2)13(15)10-5-6-12(14)18-10/h3-7,13H,1-2H3 |
| InChIKey | NDQHGGQGEHFSJY-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 31.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.59 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|