C16H18N2O3 — CID 43492884
6-[ethylamino-(3-methylfuran-2-yl)methyl]-4H-1,4-benzoxazin-3-one (PubChem CID 43492884) has the molecular formula C16H18N2O3 and a molecular weight of 286.33 g/mol. Its IUPAC name is 6-[ethylamino-(3-methylfuran-2-yl)methyl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[ethylamino-(3-methylfuran-2-yl)methyl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 43492884 |
| Molecular Formula | C16H18N2O3 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | 6-[ethylamino-(3-methylfuran-2-yl)methyl]-4H-1,4-benzoxazin-3-one |
| SMILES | CCNC(c1ccc2c(c1)NC(=O)CO2)c1occc1C |
| InChI | InChI=1S/C16H18N2O3/c1-3-17-15(16-10(2)6-7-20-16)11-4-5-13-12(8-11)18-14(19)9-21-13/h4-8,15,17H,3,9H2,1-2H3,(H,18,19) |
| InChIKey | IHJBDLFLZYMWND-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 63.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |