C16H15Cl2NO2 — CID 43492997
N-[1,3-benzodioxol-5-yl-(2,5-dichlorophenyl)methyl]ethanamine (PubChem CID 43492997) has the molecular formula C16H15Cl2NO2 and a molecular weight of 324.21 g/mol. Its IUPAC name is N-[1,3-benzodioxol-5-yl-(2,5-dichlorophenyl)methyl]ethanamine.
| Compound Name | N-[1,3-benzodioxol-5-yl-(2,5-dichlorophenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 43492997 |
| Molecular Formula | C16H15Cl2NO2 |
| Molecular Weight | 324.21 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | N-[1,3-benzodioxol-5-yl-(2,5-dichlorophenyl)methyl]ethanamine |
| SMILES | CCNC(c1ccc2c(c1)OCO2)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C16H15Cl2NO2/c1-2-19-16(12-8-11(17)4-5-13(12)18)10-3-6-14-15(7-10)21-9-20-14/h3-8,16,19H,2,9H2,1H3 |
| InChIKey | AOZDNNMZJFDFBA-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.21 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |