C9H9ClN2O3S — CID 43501980
5-chloro-2-cyano-N-(2-hydroxyethyl)benzenesulfonamide (PubChem CID 43501980) has the molecular formula C9H9ClN2O3S and a molecular weight of 260.70 g/mol. Its IUPAC name is 5-chloro-2-cyano-N-(2-hydroxyethyl)benzenesulfonamide.
| Compound Name | 5-chloro-2-cyano-N-(2-hydroxyethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 43501980 |
| Molecular Formula | C9H9ClN2O3S |
| Molecular Weight | 260.70 g/mol |
| Exact Mass | 260.00 |
| IUPAC Name | 5-chloro-2-cyano-N-(2-hydroxyethyl)benzenesulfonamide |
| SMILES | N#Cc1ccc(Cl)cc1S(=O)(=O)NCCO |
| InChI | InChI=1S/C9H9ClN2O3S/c10-8-2-1-7(6-11)9(5-8)16(14,15)12-3-4-13/h1-2,5,12-13H,3-4H2 |
| InChIKey | ULYVMLOYFOBOHR-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 90.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.70 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |