C17H28N2O — CID 43508040
2-ethyl-N-[2-[1-(propylamino)ethyl]phenyl]butanamide (PubChem CID 43508040) has the molecular formula C17H28N2O and a molecular weight of 276.42 g/mol. Its IUPAC name is 2-ethyl-N-[2-[1-(propylamino)ethyl]phenyl]butanamide.
| Compound Name | 2-ethyl-N-[2-[1-(propylamino)ethyl]phenyl]butanamide |
|---|---|
| PubChem CID | 43508040 |
| Molecular Formula | C17H28N2O |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.22 |
| IUPAC Name | 2-ethyl-N-[2-[1-(propylamino)ethyl]phenyl]butanamide |
| SMILES | CCCNC(C)c1ccccc1NC(=O)C(CC)CC |
| InChI | InChI=1S/C17H28N2O/c1-5-12-18-13(4)15-10-8-9-11-16(15)19-17(20)14(6-2)7-3/h8-11,13-14,18H,5-7,12H2,1-4H3,(H,19,20) |
| InChIKey | RZPPMCPKWTZBCL-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |