C10H14N2O3S — CID 43514150
4-(3-hydroxypropylsulfanyl)-2,6-dimethylpyrimidine-5-carboxylic acid (PubChem CID 43514150) has the molecular formula C10H14N2O3S and a molecular weight of 242.30 g/mol. Its IUPAC name is 4-(3-hydroxypropylsulfanyl)-2,6-dimethylpyrimidine-5-carboxylic acid.
| Compound Name | 4-(3-hydroxypropylsulfanyl)-2,6-dimethylpyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 43514150 |
| Molecular Formula | C10H14N2O3S |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | 4-(3-hydroxypropylsulfanyl)-2,6-dimethylpyrimidine-5-carboxylic acid |
| SMILES | Cc1nc(C)c(C(=O)O)c(SCCCO)n1 |
| InChI | InChI=1S/C10H14N2O3S/c1-6-8(10(14)15)9(12-7(2)11-6)16-5-3-4-13/h13H,3-5H2,1-2H3,(H,14,15) |
| InChIKey | QMAKSJQPTSHGGF-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 83.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|