C11H16N2O4S2 — CID 63190869
2,4-dimethyl-6-(3-methylsulfonylpropylsulfanyl)pyrimidine-5-carboxylic acid (PubChem CID 63190869) has the molecular formula C11H16N2O4S2 and a molecular weight of 304.39 g/mol. Its IUPAC name is 2,4-dimethyl-6-(3-methylsulfonylpropylsulfanyl)pyrimidine-5-carboxylic acid.
| Compound Name | 2,4-dimethyl-6-(3-methylsulfonylpropylsulfanyl)pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 63190869 |
| Molecular Formula | C11H16N2O4S2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 2,4-dimethyl-6-(3-methylsulfonylpropylsulfanyl)pyrimidine-5-carboxylic acid |
| SMILES | Cc1nc(C)c(C(=O)O)c(SCCCS(C)(=O)=O)n1 |
| InChI | InChI=1S/C11H16N2O4S2/c1-7-9(11(14)15)10(13-8(2)12-7)18-5-4-6-19(3,16)17/h4-6H2,1-3H3,(H,14,15) |
| InChIKey | RTVJUVWVYAQQBK-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 97.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|