C12H19N3O4S — CID 43521378
2-[4-[3-(2-oxo-1,3-thiazolidin-3-yl)propanoyl]piperazin-1-yl]acetic acid (PubChem CID 43521378) has the molecular formula C12H19N3O4S and a molecular weight of 301.37 g/mol. Its IUPAC name is 2-[4-[3-(2-oxo-1,3-thiazolidin-3-yl)propanoyl]piperazin-1-yl]acetic acid.
| Compound Name | 2-[4-[3-(2-oxo-1,3-thiazolidin-3-yl)propanoyl]piperazin-1-yl]acetic acid |
|---|---|
| PubChem CID | 43521378 |
| Molecular Formula | C12H19N3O4S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | 2-[4-[3-(2-oxo-1,3-thiazolidin-3-yl)propanoyl]piperazin-1-yl]acetic acid |
| SMILES | O=C(O)CN1CCN(C(=O)CCN2CCSC2=O)CC1 |
| InChI | InChI=1S/C12H19N3O4S/c16-10(1-2-15-7-8-20-12(15)19)14-5-3-13(4-6-14)9-11(17)18/h1-9H2,(H,17,18) |
| InChIKey | OPDGMAAFUWCKOC-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|