2-[methyl(1,2,5-thiadiazole-3-carbonyl)amino]acetic acid

C6H7N3O3S — CID 43522539

IUPAC2-[methyl(1,2,5-thiadiazole-3-carbonyl)amino]acetic acid
SMILESCN(CC(=O)O)C(=O)c1cnsn1
InChIInChI=1S/C6H7N3O3S/c1-9(3-5(10)11)6(12)4-2-7-13-8-4/h2H,3H2,1H3,(H,10,11)
InChIKeyIPKBWOBMLZLIQE-UHFFFAOYSA-N
MW201.21 g/mol
LogP-0.31
Rot. Bonds3

About 2-[methyl(1,2,5-thiadiazole-3-carbonyl)amino]acetic acid

2-[methyl(1,2,5-thiadiazole-3-carbonyl)amino]acetic acid (PubChem CID 43522539) has the molecular formula C6H7N3O3S and a molecular weight of 201.21 g/mol. Its IUPAC name is 2-[methyl(1,2,5-thiadiazole-3-carbonyl)amino]acetic acid.

Molecular Properties

Compound Name2-[methyl(1,2,5-thiadiazole-3-carbonyl)amino]acetic acid
PubChem CID43522539
Molecular FormulaC6H7N3O3S
Molecular Weight201.21 g/mol
Exact Mass201.02
IUPAC Name2-[methyl(1,2,5-thiadiazole-3-carbonyl)amino]acetic acid
SMILESCN(CC(=O)O)C(=O)c1cnsn1
InChIInChI=1S/C6H7N3O3S/c1-9(3-5(10)11)6(12)4-2-7-13-8-4/h2H,3H2,1H3,(H,10,11)
InChIKeyIPKBWOBMLZLIQE-UHFFFAOYSA-N
XLogP-0.31
TPSA83.39 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500201.21
LogP ≤ 5-0.31
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 2-[methyl(1,2,5-thiadiazole-3-carbonyl)amino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[methyl(1,2,5-thiadiazole-3-carbonyl)amino]acetic acid?
The IUPAC name of 2-[methyl(1,2,5-thiadiazole-3-carbonyl)amino]acetic acid (CID 43522539) is 2-[methyl(1,2,5-thiadiazole-3-carbonyl)amino]acetic acid.
What is the SMILES notation for 2-[methyl(1,2,5-thiadiazole-3-carbonyl)amino]acetic acid?
The canonical SMILES for 2-[methyl(1,2,5-thiadiazole-3-carbonyl)amino]acetic acid is CN(CC(=O)O)C(=O)c1cnsn1.
What is the InChIKey of 2-[methyl(1,2,5-thiadiazole-3-carbonyl)amino]acetic acid?
The InChIKey is IPKBWOBMLZLIQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N3O3S/c1-9(3-5(10)11)6(12)4-2-7-13-8-4/h2H,3H2,1H3,(H,10,11).
What are the key properties of 2-[methyl(1,2,5-thiadiazole-3-carbonyl)amino]acetic acid?
2-[methyl(1,2,5-thiadiazole-3-carbonyl)amino]acetic acid has a molecular weight of 201.21 g/mol, XLogP of -0.31, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[methyl(1,2,5-thiadiazole-3-carbonyl)amino]acetic acid is sourced from PubChem (CID 43522539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).