C15H21NO2S — CID 43522978
N-cycloheptyl-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-amine (PubChem CID 43522978) has the molecular formula C15H21NO2S and a molecular weight of 279.40 g/mol. Its IUPAC name is N-cycloheptyl-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-amine.
| Compound Name | N-cycloheptyl-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-amine |
|---|---|
| PubChem CID | 43522978 |
| Molecular Formula | C15H21NO2S |
| Molecular Weight | 279.40 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | N-cycloheptyl-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-amine |
| SMILES | O=S1(=O)CC(NC2CCCCCC2)c2ccccc21 |
| InChI | InChI=1S/C15H21NO2S/c17-19(18)11-14(13-9-5-6-10-15(13)19)16-12-7-3-1-2-4-8-12/h5-6,9-10,12,14,16H,1-4,7-8,11H2 |
| InChIKey | CEYQUJCMDSEJCZ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.40 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |