C13H12ClN3O2 — CID 43523832
2-chloro-6-(1-pyridin-3-ylethylamino)pyridine-4-carboxylic acid (PubChem CID 43523832) has the molecular formula C13H12ClN3O2 and a molecular weight of 277.71 g/mol. Its IUPAC name is 2-chloro-6-(1-pyridin-3-ylethylamino)pyridine-4-carboxylic acid.
| Compound Name | 2-chloro-6-(1-pyridin-3-ylethylamino)pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 43523832 |
| Molecular Formula | C13H12ClN3O2 |
| Molecular Weight | 277.71 g/mol |
| Exact Mass | 277.06 |
| IUPAC Name | 2-chloro-6-(1-pyridin-3-ylethylamino)pyridine-4-carboxylic acid |
| SMILES | CC(Nc1cc(C(=O)O)cc(Cl)n1)c1cccnc1 |
| InChI | InChI=1S/C13H12ClN3O2/c1-8(9-3-2-4-15-7-9)16-12-6-10(13(18)19)5-11(14)17-12/h2-8H,1H3,(H,16,17)(H,18,19) |
| InChIKey | BMCYPMGCNIIDQB-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.71 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|