C7H14N4O — CID 43524828
2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methylamino]ethanol (PubChem CID 43524828) has the molecular formula C7H14N4O and a molecular weight of 170.22 g/mol. Its IUPAC name is 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methylamino]ethanol.
| Compound Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methylamino]ethanol |
|---|---|
| PubChem CID | 43524828 |
| Molecular Formula | C7H14N4O |
| Molecular Weight | 170.22 g/mol |
| Exact Mass | 170.12 |
| IUPAC Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methylamino]ethanol |
| SMILES | Cc1nnc(CNCCO)n1C |
| InChI | InChI=1S/C7H14N4O/c1-6-9-10-7(11(6)2)5-8-3-4-12/h8,12H,3-5H2,1-2H3 |
| InChIKey | IEYHXLPYHJAIEV-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.22 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|