C13H9ClN2O2S2 — CID 43525509
3-(5-chloro-2-methoxyphenyl)-2-sulfanylidene-1H-thieno[3,2-d]pyrimidin-4-one (PubChem CID 43525509) has the molecular formula C13H9ClN2O2S2 and a molecular weight of 324.81 g/mol. Its IUPAC name is 3-(5-chloro-2-methoxyphenyl)-2-sulfanylidene-1H-thieno[3,2-d]pyrimidin-4-one.
| Compound Name | 3-(5-chloro-2-methoxyphenyl)-2-sulfanylidene-1H-thieno[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 43525509 |
| Molecular Formula | C13H9ClN2O2S2 |
| Molecular Weight | 324.81 g/mol |
| Exact Mass | 323.98 |
| IUPAC Name | 3-(5-chloro-2-methoxyphenyl)-2-sulfanylidene-1H-thieno[3,2-d]pyrimidin-4-one |
| SMILES | COc1ccc(Cl)cc1-n1c(=S)[nH]c2ccsc2c1=O |
| InChI | InChI=1S/C13H9ClN2O2S2/c1-18-10-3-2-7(14)6-9(10)16-12(17)11-8(4-5-20-11)15-13(16)19/h2-6H,1H3,(H,15,19) |
| InChIKey | GFAGERISZGQVMH-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 47.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.81 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|