C13H9N3O2S2 — CID 107809207
3-(4-oxo-2-sulfanylidene-1H-thieno[3,2-d]pyrimidin-3-yl)benzamide (PubChem CID 107809207) has the molecular formula C13H9N3O2S2 and a molecular weight of 303.37 g/mol. Its IUPAC name is 3-(4-oxo-2-sulfanylidene-1H-thieno[3,2-d]pyrimidin-3-yl)benzamide.
| Compound Name | 3-(4-oxo-2-sulfanylidene-1H-thieno[3,2-d]pyrimidin-3-yl)benzamide |
|---|---|
| PubChem CID | 107809207 |
| Molecular Formula | C13H9N3O2S2 |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.01 |
| IUPAC Name | 3-(4-oxo-2-sulfanylidene-1H-thieno[3,2-d]pyrimidin-3-yl)benzamide |
| SMILES | NC(=O)c1cccc(-n2c(=S)[nH]c3ccsc3c2=O)c1 |
| InChI | InChI=1S/C13H9N3O2S2/c14-11(17)7-2-1-3-8(6-7)16-12(18)10-9(4-5-20-10)15-13(16)19/h1-6H,(H2,14,17)(H,15,19) |
| InChIKey | YFELZXCIVHCLGT-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 80.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|