C10H17N3O3S — CID 43527042
N-(furan-2-ylmethyl)-N-methylpiperazine-1-sulfonamide (PubChem CID 43527042) has the molecular formula C10H17N3O3S and a molecular weight of 259.33 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-N-methylpiperazine-1-sulfonamide.
| Compound Name | N-(furan-2-ylmethyl)-N-methylpiperazine-1-sulfonamide |
|---|---|
| PubChem CID | 43527042 |
| Molecular Formula | C10H17N3O3S |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | N-(furan-2-ylmethyl)-N-methylpiperazine-1-sulfonamide |
| SMILES | CN(Cc1ccco1)S(=O)(=O)N1CCNCC1 |
| InChI | InChI=1S/C10H17N3O3S/c1-12(9-10-3-2-8-16-10)17(14,15)13-6-4-11-5-7-13/h2-3,8,11H,4-7,9H2,1H3 |
| InChIKey | KPWALZXDMLFPTR-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |