C14H16N2OS — CID 43527192
3-amino-N,2-dimethyl-N-(thiophen-2-ylmethyl)benzamide (PubChem CID 43527192) has the molecular formula C14H16N2OS and a molecular weight of 260.36 g/mol. Its IUPAC name is 3-amino-N,2-dimethyl-N-(thiophen-2-ylmethyl)benzamide.
| Compound Name | 3-amino-N,2-dimethyl-N-(thiophen-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 43527192 |
| Molecular Formula | C14H16N2OS |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 3-amino-N,2-dimethyl-N-(thiophen-2-ylmethyl)benzamide |
| SMILES | Cc1c(N)cccc1C(=O)N(C)Cc1cccs1 |
| InChI | InChI=1S/C14H16N2OS/c1-10-12(6-3-7-13(10)15)14(17)16(2)9-11-5-4-8-18-11/h3-8H,9,15H2,1-2H3 |
| InChIKey | JHTZYSRSOGBKQR-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|