C14H16N2O2 — CID 61421960
3-amino-N-(furan-3-ylmethyl)-N,2-dimethylbenzamide (PubChem CID 61421960) has the molecular formula C14H16N2O2 and a molecular weight of 244.29 g/mol. Its IUPAC name is 3-amino-N-(furan-3-ylmethyl)-N,2-dimethylbenzamide.
| Compound Name | 3-amino-N-(furan-3-ylmethyl)-N,2-dimethylbenzamide |
|---|---|
| PubChem CID | 61421960 |
| Molecular Formula | C14H16N2O2 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | 3-amino-N-(furan-3-ylmethyl)-N,2-dimethylbenzamide |
| SMILES | Cc1c(N)cccc1C(=O)N(C)Cc1ccoc1 |
| InChI | InChI=1S/C14H16N2O2/c1-10-12(4-3-5-13(10)15)14(17)16(2)8-11-6-7-18-9-11/h3-7,9H,8,15H2,1-2H3 |
| InChIKey | WRWQMOBUUGKKTH-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 59.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|