C13H13NO4 — CID 107722501
N-(furan-3-ylmethyl)-2,5-dihydroxy-N-methylbenzamide (PubChem CID 107722501) has the molecular formula C13H13NO4 and a molecular weight of 247.25 g/mol. Its IUPAC name is N-(furan-3-ylmethyl)-2,5-dihydroxy-N-methylbenzamide.
| Compound Name | N-(furan-3-ylmethyl)-2,5-dihydroxy-N-methylbenzamide |
|---|---|
| PubChem CID | 107722501 |
| Molecular Formula | C13H13NO4 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | N-(furan-3-ylmethyl)-2,5-dihydroxy-N-methylbenzamide |
| SMILES | CN(Cc1ccoc1)C(=O)c1cc(O)ccc1O |
| InChI | InChI=1S/C13H13NO4/c1-14(7-9-4-5-18-8-9)13(17)11-6-10(15)2-3-12(11)16/h2-6,8,15-16H,7H2,1H3 |
| InChIKey | VRCOWLYZLSJJSW-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|