C11H13N5S — CID 43528934
[4-(1-cyclopropyltetrazol-5-yl)sulfanylphenyl]methanamine (PubChem CID 43528934) has the molecular formula C11H13N5S and a molecular weight of 247.33 g/mol. Its IUPAC name is [4-(1-cyclopropyltetrazol-5-yl)sulfanylphenyl]methanamine.
| Compound Name | [4-(1-cyclopropyltetrazol-5-yl)sulfanylphenyl]methanamine |
|---|---|
| PubChem CID | 43528934 |
| Molecular Formula | C11H13N5S |
| Molecular Weight | 247.33 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | [4-(1-cyclopropyltetrazol-5-yl)sulfanylphenyl]methanamine |
| SMILES | NCc1ccc(Sc2nnnn2C2CC2)cc1 |
| InChI | InChI=1S/C11H13N5S/c12-7-8-1-5-10(6-2-8)17-11-13-14-15-16(11)9-3-4-9/h1-2,5-6,9H,3-4,7,12H2 |
| InChIKey | FZJPAJONWWXVMN-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.33 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |