C12H14N4OS — CID 63814749
[4-(1-cyclopropyltetrazol-5-yl)sulfanyl-2-methylphenyl]methanol (PubChem CID 63814749) has the molecular formula C12H14N4OS and a molecular weight of 262.34 g/mol. Its IUPAC name is [4-(1-cyclopropyltetrazol-5-yl)sulfanyl-2-methylphenyl]methanol.
| Compound Name | [4-(1-cyclopropyltetrazol-5-yl)sulfanyl-2-methylphenyl]methanol |
|---|---|
| PubChem CID | 63814749 |
| Molecular Formula | C12H14N4OS |
| Molecular Weight | 262.34 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | [4-(1-cyclopropyltetrazol-5-yl)sulfanyl-2-methylphenyl]methanol |
| SMILES | Cc1cc(Sc2nnnn2C2CC2)ccc1CO |
| InChI | InChI=1S/C12H14N4OS/c1-8-6-11(5-2-9(8)7-17)18-12-13-14-15-16(12)10-3-4-10/h2,5-6,10,17H,3-4,7H2,1H3 |
| InChIKey | UTRZBYHXIDCUSI-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.34 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |