C16H23F2NS — CID 43529894
[2-(2,4-difluorophenyl)sulfanyl-4-propylcyclohexyl]methanamine (PubChem CID 43529894) has the molecular formula C16H23F2NS and a molecular weight of 299.43 g/mol. Its IUPAC name is [2-(2,4-difluorophenyl)sulfanyl-4-propylcyclohexyl]methanamine.
| Compound Name | [2-(2,4-difluorophenyl)sulfanyl-4-propylcyclohexyl]methanamine |
|---|---|
| PubChem CID | 43529894 |
| Molecular Formula | C16H23F2NS |
| Molecular Weight | 299.43 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | [2-(2,4-difluorophenyl)sulfanyl-4-propylcyclohexyl]methanamine |
| SMILES | CCCC1CCC(CN)C(Sc2ccc(F)cc2F)C1 |
| InChI | InChI=1S/C16H23F2NS/c1-2-3-11-4-5-12(10-19)16(8-11)20-15-7-6-13(17)9-14(15)18/h6-7,9,11-12,16H,2-5,8,10,19H2,1H3 |
| InChIKey | HIZCSITZUJFYBD-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.43 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |