C18H21NOS — CID 43530717
[3-[2-(2,3-dihydro-1H-inden-5-ylsulfanyl)ethoxy]phenyl]methanamine (PubChem CID 43530717) has the molecular formula C18H21NOS and a molecular weight of 299.44 g/mol. Its IUPAC name is [3-[2-(2,3-dihydro-1H-inden-5-ylsulfanyl)ethoxy]phenyl]methanamine.
| Compound Name | [3-[2-(2,3-dihydro-1H-inden-5-ylsulfanyl)ethoxy]phenyl]methanamine |
|---|---|
| PubChem CID | 43530717 |
| Molecular Formula | C18H21NOS |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | [3-[2-(2,3-dihydro-1H-inden-5-ylsulfanyl)ethoxy]phenyl]methanamine |
| SMILES | NCc1cccc(OCCSc2ccc3c(c2)CCC3)c1 |
| InChI | InChI=1S/C18H21NOS/c19-13-14-3-1-6-17(11-14)20-9-10-21-18-8-7-15-4-2-5-16(15)12-18/h1,3,6-8,11-12H,2,4-5,9-10,13,19H2 |
| InChIKey | KXFJAVBXIVMBID-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|