C10H22N2S — CID 43530808
3-N-methyl-3-N-(thiolan-3-yl)pentane-1,3-diamine (PubChem CID 43530808) has the molecular formula C10H22N2S and a molecular weight of 202.37 g/mol. Its IUPAC name is 3-N-methyl-3-N-(thiolan-3-yl)pentane-1,3-diamine.
| Compound Name | 3-N-methyl-3-N-(thiolan-3-yl)pentane-1,3-diamine |
|---|---|
| PubChem CID | 43530808 |
| Molecular Formula | C10H22N2S |
| Molecular Weight | 202.37 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 3-N-methyl-3-N-(thiolan-3-yl)pentane-1,3-diamine |
| SMILES | CCC(CCN)N(C)C1CCSC1 |
| InChI | InChI=1S/C10H22N2S/c1-3-9(4-6-11)12(2)10-5-7-13-8-10/h9-10H,3-8,11H2,1-2H3 |
| InChIKey | VWGWKTBHABNNHO-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.37 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |