C9H13ClN2O3S2 — CID 43533896
2-chloro-N-[1-(oxolan-2-yl)ethyl]-1,3-thiazole-5-sulfonamide (PubChem CID 43533896) has the molecular formula C9H13ClN2O3S2 and a molecular weight of 296.80 g/mol. Its IUPAC name is 2-chloro-N-[1-(oxolan-2-yl)ethyl]-1,3-thiazole-5-sulfonamide.
| Compound Name | 2-chloro-N-[1-(oxolan-2-yl)ethyl]-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 43533896 |
| Molecular Formula | C9H13ClN2O3S2 |
| Molecular Weight | 296.80 g/mol |
| Exact Mass | 296.01 |
| IUPAC Name | 2-chloro-N-[1-(oxolan-2-yl)ethyl]-1,3-thiazole-5-sulfonamide |
| SMILES | CC(NS(=O)(=O)c1cnc(Cl)s1)C1CCCO1 |
| InChI | InChI=1S/C9H13ClN2O3S2/c1-6(7-3-2-4-15-7)12-17(13,14)8-5-11-9(10)16-8/h5-7,12H,2-4H2,1H3 |
| InChIKey | KYIAFXQQSNEAEX-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.80 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |