C12H16ClNO5S2 — CID 43533925
3-[1-(oxolan-2-yl)ethylsulfamoyl]benzenesulfonyl chloride (PubChem CID 43533925) has the molecular formula C12H16ClNO5S2 and a molecular weight of 353.85 g/mol. Its IUPAC name is 3-[1-(oxolan-2-yl)ethylsulfamoyl]benzenesulfonyl chloride.
| Compound Name | 3-[1-(oxolan-2-yl)ethylsulfamoyl]benzenesulfonyl chloride |
|---|---|
| PubChem CID | 43533925 |
| Molecular Formula | C12H16ClNO5S2 |
| Molecular Weight | 353.85 g/mol |
| Exact Mass | 353.02 |
| IUPAC Name | 3-[1-(oxolan-2-yl)ethylsulfamoyl]benzenesulfonyl chloride |
| SMILES | CC(NS(=O)(=O)c1cccc(S(=O)(=O)Cl)c1)C1CCCO1 |
| InChI | InChI=1S/C12H16ClNO5S2/c1-9(12-6-3-7-19-12)14-21(17,18)11-5-2-4-10(8-11)20(13,15)16/h2,4-5,8-9,12,14H,3,6-7H2,1H3 |
| InChIKey | SUHDIIUPRRRBFL-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.85 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |