C13H17NS2 — CID 43534521
N-[(5-ethylthiophen-2-yl)methyl]-1-thiophen-2-ylethanamine (PubChem CID 43534521) has the molecular formula C13H17NS2 and a molecular weight of 251.42 g/mol. Its IUPAC name is N-[(5-ethylthiophen-2-yl)methyl]-1-thiophen-2-ylethanamine.
| Compound Name | N-[(5-ethylthiophen-2-yl)methyl]-1-thiophen-2-ylethanamine |
|---|---|
| PubChem CID | 43534521 |
| Molecular Formula | C13H17NS2 |
| Molecular Weight | 251.42 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | N-[(5-ethylthiophen-2-yl)methyl]-1-thiophen-2-ylethanamine |
| SMILES | CCc1ccc(CNC(C)c2cccs2)s1 |
| InChI | InChI=1S/C13H17NS2/c1-3-11-6-7-12(16-11)9-14-10(2)13-5-4-8-15-13/h4-8,10,14H,3,9H2,1-2H3 |
| InChIKey | KHMUZTXUFGXDSE-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.42 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |