C12H16ClNO — CID 43537828
8-chloro-N,3,5-trimethyl-3,4-dihydro-2H-chromen-4-amine (PubChem CID 43537828) has the molecular formula C12H16ClNO and a molecular weight of 225.72 g/mol. Its IUPAC name is 8-chloro-N,3,5-trimethyl-3,4-dihydro-2H-chromen-4-amine.
| Compound Name | 8-chloro-N,3,5-trimethyl-3,4-dihydro-2H-chromen-4-amine |
|---|---|
| PubChem CID | 43537828 |
| Molecular Formula | C12H16ClNO |
| Molecular Weight | 225.72 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | 8-chloro-N,3,5-trimethyl-3,4-dihydro-2H-chromen-4-amine |
| SMILES | CNC1c2c(C)ccc(Cl)c2OCC1C |
| InChI | InChI=1S/C12H16ClNO/c1-7-4-5-9(13)12-10(7)11(14-3)8(2)6-15-12/h4-5,8,11,14H,6H2,1-3H3 |
| InChIKey | VYHBZBWDONFQEE-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.72 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |