C12H17ClO — CID 143804356
7-chloro-3,6-dimethyl-2,3-dihydro-1-benzofuran;ethane (PubChem CID 143804356) has the molecular formula C12H17ClO and a molecular weight of 212.72 g/mol. Its IUPAC name is 7-chloro-3,6-dimethyl-2,3-dihydro-1-benzofuran;ethane.
| Compound Name | 7-chloro-3,6-dimethyl-2,3-dihydro-1-benzofuran;ethane |
|---|---|
| PubChem CID | 143804356 |
| Molecular Formula | C12H17ClO |
| Molecular Weight | 212.72 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 7-chloro-3,6-dimethyl-2,3-dihydro-1-benzofuran;ethane |
| SMILES | CC.Cc1ccc2c(c1Cl)OCC2C |
| InChI | InChI=1S/C10H11ClO.C2H6/c1-6-3-4-8-7(2)5-12-10(8)9(6)11;1-2/h3-4,7H,5H2,1-2H3;1-2H3 |
| InChIKey | JFRZEQFGTVZOGP-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.72 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |