C18H27NO — CID 142075796
4,8-dimethyl-2-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-10-amine;ethane (PubChem CID 142075796) has the molecular formula C18H27NO and a molecular weight of 273.42 g/mol. Its IUPAC name is 4,8-dimethyl-2-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-10-amine;ethane.
| Compound Name | 4,8-dimethyl-2-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-10-amine;ethane |
|---|---|
| PubChem CID | 142075796 |
| Molecular Formula | C18H27NO |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.21 |
| IUPAC Name | 4,8-dimethyl-2-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-10-amine;ethane |
| SMILES | CC.CC.Cc1ccc2c3c(ccc(N)c13)OCC2C |
| InChI | InChI=1S/C14H15NO.2C2H6/c1-8-3-4-10-9(2)7-16-12-6-5-11(15)13(8)14(10)12;2*1-2/h3-6,9H,7,15H2,1-2H3;2*1-2H3 |
| InChIKey | JBRQACPFFTXZTJ-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|