C12H15NO2 — CID 82230329
3,5,9-trimethyl-2,3-dihydro-1,5-benzoxazepin-4-one (PubChem CID 82230329) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is 3,5,9-trimethyl-2,3-dihydro-1,5-benzoxazepin-4-one.
| Compound Name | 3,5,9-trimethyl-2,3-dihydro-1,5-benzoxazepin-4-one |
|---|---|
| PubChem CID | 82230329 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 3,5,9-trimethyl-2,3-dihydro-1,5-benzoxazepin-4-one |
| SMILES | Cc1cccc2c1OCC(C)C(=O)N2C |
| InChI | InChI=1S/C12H15NO2/c1-8-5-4-6-10-11(8)15-7-9(2)12(14)13(10)3/h4-6,9H,7H2,1-3H3 |
| InChIKey | YMSDHWDMVDYLLZ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |