C13H17ClN2O2 — CID 82233422
9-amino-7-chloro-3,5,6,8-tetramethyl-2,3-dihydro-1,5-benzoxazepin-4-one (PubChem CID 82233422) has the molecular formula C13H17ClN2O2 and a molecular weight of 268.74 g/mol. Its IUPAC name is 9-amino-7-chloro-3,5,6,8-tetramethyl-2,3-dihydro-1,5-benzoxazepin-4-one.
| Compound Name | 9-amino-7-chloro-3,5,6,8-tetramethyl-2,3-dihydro-1,5-benzoxazepin-4-one |
|---|---|
| PubChem CID | 82233422 |
| Molecular Formula | C13H17ClN2O2 |
| Molecular Weight | 268.74 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 9-amino-7-chloro-3,5,6,8-tetramethyl-2,3-dihydro-1,5-benzoxazepin-4-one |
| SMILES | Cc1c(N)c2c(c(C)c1Cl)N(C)C(=O)C(C)CO2 |
| InChI | InChI=1S/C13H17ClN2O2/c1-6-5-18-12-10(15)7(2)9(14)8(3)11(12)16(4)13(6)17/h6H,5,15H2,1-4H3 |
| InChIKey | HMCHSVOAUNOGDO-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.74 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|