C12H14ClNO2 — CID 82231832
6-chloro-2,4,5,7-tetramethyl-1,4-benzoxazin-3-one (PubChem CID 82231832) has the molecular formula C12H14ClNO2 and a molecular weight of 239.70 g/mol. Its IUPAC name is 6-chloro-2,4,5,7-tetramethyl-1,4-benzoxazin-3-one.
| Compound Name | 6-chloro-2,4,5,7-tetramethyl-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 82231832 |
| Molecular Formula | C12H14ClNO2 |
| Molecular Weight | 239.70 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | 6-chloro-2,4,5,7-tetramethyl-1,4-benzoxazin-3-one |
| SMILES | Cc1cc2c(c(C)c1Cl)N(C)C(=O)C(C)O2 |
| InChI | InChI=1S/C12H14ClNO2/c1-6-5-9-11(7(2)10(6)13)14(4)12(15)8(3)16-9/h5,8H,1-4H3 |
| InChIKey | BXUDBYVINWGTBW-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.70 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |