C14H19N3O2 — CID 116995017
2,4-dimethyl-7-piperazin-1-yl-1,4-benzoxazin-3-one (PubChem CID 116995017) has the molecular formula C14H19N3O2 and a molecular weight of 261.32 g/mol. Its IUPAC name is 2,4-dimethyl-7-piperazin-1-yl-1,4-benzoxazin-3-one.
| Compound Name | 2,4-dimethyl-7-piperazin-1-yl-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 116995017 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 2,4-dimethyl-7-piperazin-1-yl-1,4-benzoxazin-3-one |
| SMILES | CC1Oc2cc(N3CCNCC3)ccc2N(C)C1=O |
| InChI | InChI=1S/C14H19N3O2/c1-10-14(18)16(2)12-4-3-11(9-13(12)19-10)17-7-5-15-6-8-17/h3-4,9-10,15H,5-8H2,1-2H3 |
| InChIKey | RHHIMBATJSATMZ-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |