C10H9ClN2O4 — CID 58651139
(2R)-6-chloro-2,4-dimethyl-8-nitro-1,4-benzoxazin-3-one (PubChem CID 58651139) has the molecular formula C10H9ClN2O4 and a molecular weight of 256.65 g/mol. Its IUPAC name is (2R)-6-chloro-2,4-dimethyl-8-nitro-1,4-benzoxazin-3-one.
| Compound Name | (2R)-6-chloro-2,4-dimethyl-8-nitro-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 58651139 |
| Molecular Formula | C10H9ClN2O4 |
| Molecular Weight | 256.65 g/mol |
| Exact Mass | 256.03 |
| IUPAC Name | (2R)-6-chloro-2,4-dimethyl-8-nitro-1,4-benzoxazin-3-one |
| SMILES | C[C@H]1Oc2c(cc(Cl)cc2[N+](=O)[O-])N(C)C1=O |
| InChI | InChI=1S/C10H9ClN2O4/c1-5-10(14)12(2)7-3-6(11)4-8(13(15)16)9(7)17-5/h3-5H,1-2H3/t5-/m1/s1 |
| InChIKey | GSIYTZJNTZWKLH-RXMQYKEDSA-N |
| XLogP | 1.99 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.65 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|