About (6-chloro-3-oxo-1,4-benzoxazin-4-yl) pentanoate
(6-chloro-3-oxo-1,4-benzoxazin-4-yl) pentanoate (PubChem CID 46183858) has the molecular formula C13H14ClNO4
and a molecular weight of 283.71 g/mol. Its IUPAC name is (6-chloro-3-oxo-1,4-benzoxazin-4-yl) pentanoate.
Molecular Properties
| Compound Name | (6-chloro-3-oxo-1,4-benzoxazin-4-yl) pentanoate |
| PubChem CID | 46183858 |
| Molecular Formula | C13H14ClNO4 |
| Molecular Weight | 283.71 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | (6-chloro-3-oxo-1,4-benzoxazin-4-yl) pentanoate |
| SMILES | CCCCC(=O)ON1C(=O)COc2ccc(Cl)cc21 |
| InChI | InChI=1S/C13H14ClNO4/c1-2-3-4-13(17)19-15-10-7-9(14)5-6-11(10)18-8-12(15)16/h5-7H,2-4,8H2,1H3 |
| InChIKey | JLMUTZRHFKPFRY-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.71 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (6-chloro-3-oxo-1,4-benzoxazin-4-yl) pentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-chloro-3-oxo-1,4-benzoxazin-4-yl) pentanoate?
The IUPAC name of (6-chloro-3-oxo-1,4-benzoxazin-4-yl) pentanoate (CID 46183858) is (6-chloro-3-oxo-1,4-benzoxazin-4-yl) pentanoate.
What is the SMILES notation for (6-chloro-3-oxo-1,4-benzoxazin-4-yl) pentanoate?
The canonical SMILES for (6-chloro-3-oxo-1,4-benzoxazin-4-yl) pentanoate is CCCCC(=O)ON1C(=O)COc2ccc(Cl)cc21.
What is the InChIKey of (6-chloro-3-oxo-1,4-benzoxazin-4-yl) pentanoate?
The InChIKey is JLMUTZRHFKPFRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14ClNO4/c1-2-3-4-13(17)19-15-10-7-9(14)5-6-11(10)18-8-12(15)16/h5-7H,2-4,8H2,1H3.
What are the key properties of (6-chloro-3-oxo-1,4-benzoxazin-4-yl) pentanoate?
(6-chloro-3-oxo-1,4-benzoxazin-4-yl) pentanoate has a molecular weight of 283.71 g/mol, XLogP of 2.71, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6-chloro-3-oxo-1,4-benzoxazin-4-yl) pentanoate is sourced from PubChem (CID 46183858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).