C11H13NO2 — CID 83753043
2,4,5-trimethyl-1,4-benzoxazin-3-one (PubChem CID 83753043) has the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. Its IUPAC name is 2,4,5-trimethyl-1,4-benzoxazin-3-one.
| Compound Name | 2,4,5-trimethyl-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 83753043 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | 2,4,5-trimethyl-1,4-benzoxazin-3-one |
| SMILES | Cc1cccc2c1N(C)C(=O)C(C)O2 |
| InChI | InChI=1S/C11H13NO2/c1-7-5-4-6-9-10(7)12(3)11(13)8(2)14-9/h4-6,8H,1-3H3 |
| InChIKey | IRPQILVQPWIVPD-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |