C15H21N3O3 — CID 82345993
5-amino-2-methyl-4-(2-morpholin-4-ylethyl)-1,4-benzoxazin-3-one (PubChem CID 82345993) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is 5-amino-2-methyl-4-(2-morpholin-4-ylethyl)-1,4-benzoxazin-3-one.
| Compound Name | 5-amino-2-methyl-4-(2-morpholin-4-ylethyl)-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 82345993 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | 5-amino-2-methyl-4-(2-morpholin-4-ylethyl)-1,4-benzoxazin-3-one |
| SMILES | CC1Oc2cccc(N)c2N(CCN2CCOCC2)C1=O |
| InChI | InChI=1S/C15H21N3O3/c1-11-15(19)18(6-5-17-7-9-20-10-8-17)14-12(16)3-2-4-13(14)21-11/h2-4,11H,5-10,16H2,1H3 |
| InChIKey | LQINFQZFJZOYAC-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 68.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|