C13H16N2O4 — CID 82345996
2-(5-amino-2-methyl-3-oxo-1,4-benzoxazin-4-yl)-2-methylpropanoic acid (PubChem CID 82345996) has the molecular formula C13H16N2O4 and a molecular weight of 264.28 g/mol. Its IUPAC name is 2-(5-amino-2-methyl-3-oxo-1,4-benzoxazin-4-yl)-2-methylpropanoic acid.
| Compound Name | 2-(5-amino-2-methyl-3-oxo-1,4-benzoxazin-4-yl)-2-methylpropanoic acid |
|---|---|
| PubChem CID | 82345996 |
| Molecular Formula | C13H16N2O4 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 2-(5-amino-2-methyl-3-oxo-1,4-benzoxazin-4-yl)-2-methylpropanoic acid |
| SMILES | CC1Oc2cccc(N)c2N(C(C)(C)C(=O)O)C1=O |
| InChI | InChI=1S/C13H16N2O4/c1-7-11(16)15(13(2,3)12(17)18)10-8(14)5-4-6-9(10)19-7/h4-7H,14H2,1-3H3,(H,17,18) |
| InChIKey | HBUOKBJIZSOLHK-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|