C15H20N2O4 — CID 82345948
propan-2-yl 2-(5-amino-2-methyl-3-oxo-1,4-benzoxazin-4-yl)propanoate (PubChem CID 82345948) has the molecular formula C15H20N2O4 and a molecular weight of 292.34 g/mol. Its IUPAC name is propan-2-yl 2-(5-amino-2-methyl-3-oxo-1,4-benzoxazin-4-yl)propanoate.
| Compound Name | propan-2-yl 2-(5-amino-2-methyl-3-oxo-1,4-benzoxazin-4-yl)propanoate |
|---|---|
| PubChem CID | 82345948 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | propan-2-yl 2-(5-amino-2-methyl-3-oxo-1,4-benzoxazin-4-yl)propanoate |
| SMILES | CC(C)OC(=O)C(C)N1C(=O)C(C)Oc2cccc(N)c21 |
| InChI | InChI=1S/C15H20N2O4/c1-8(2)20-15(19)9(3)17-13-11(16)6-5-7-12(13)21-10(4)14(17)18/h5-10H,16H2,1-4H3 |
| InChIKey | NOWBMKSINXAQIW-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|