C13H19NS — CID 43539077
N-ethyl-2,6-dimethyl-3,4-dihydro-2H-thiochromen-4-amine (PubChem CID 43539077) has the molecular formula C13H19NS and a molecular weight of 221.37 g/mol. Its IUPAC name is N-ethyl-2,6-dimethyl-3,4-dihydro-2H-thiochromen-4-amine.
| Compound Name | N-ethyl-2,6-dimethyl-3,4-dihydro-2H-thiochromen-4-amine |
|---|---|
| PubChem CID | 43539077 |
| Molecular Formula | C13H19NS |
| Molecular Weight | 221.37 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | N-ethyl-2,6-dimethyl-3,4-dihydro-2H-thiochromen-4-amine |
| SMILES | CCNC1CC(C)Sc2ccc(C)cc21 |
| InChI | InChI=1S/C13H19NS/c1-4-14-12-8-10(3)15-13-6-5-9(2)7-11(12)13/h5-7,10,12,14H,4,8H2,1-3H3 |
| InChIKey | NHJUTUMBAYZZMS-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.37 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |